alpha-D-xylofuranose, 1,2-O-(1-methylethylidene)-
1,2-O-Isopropylidene-alpha-D-xylofuranose
CAS: 20031-21-4
Molecular Formula: C8H14O5
alpha-D-xylofuranose, 1,2-O-(1-methylethylidene)- - Names and Identifiers
| Name | 1,2-O-Isopropylidene-alpha-D-xylofuranose |
| Synonyms | Monoacetone-D-xylose 1,2-O-Isoproplyidene-a-d-xylofuranose 1,2-O-Isopropylidene-alpha-D-xylofuran 1,2-isopropylidene-alpha-D-xylofuranose 1,2-Di-O-isopropylidene-α-D-xylofuranose 1,2-O-Isopropylidene-alpha-D-xylofuranose 1,2-Di-O-isopropylidene-alpha-D-xylofuranose 1,2-o-(1-methylethylidene)-alpha-d-xylofuranos 1,2-O-(1-methylethylidene)-alpha-D-xylofuranose alpha-D-xylofuranose, 1,2-O-(1-methylethylidene)- 1,2-O-(1-methylethylidene)-alpha-D-arabinofuranose .alpha.-d-Xylofuranose, 1,2-O-(1-methylethylidene)- |
| CAS | 20031-21-4 |
| EINECS | 606-426-9 |
| InChI | InChI=1/C8H14O5/c1-8(2)12-6-5(10)4(3-9)11-7(6)13-8/h4-7,9-10H,3H2,1-2H3/t4-,5-,6+,7-/m1/s1 |
| InChIKey | JAUQZVBVVJJRKM-VZFHVOOUSA-N |
alpha-D-xylofuranose, 1,2-O-(1-methylethylidene)- - Physico-chemical Properties
| Molecular Formula | C8H14O5 |
| Molar Mass | 190.2 |
| Density | 1.2422 (rough estimate) |
| Melting Point | 69-71°C(lit.) |
| Boling Point | 112-114°C0.06mm Hg(lit.) |
| Specific Rotation(α) | -19.2 º (C=1 IN H2O) |
| Flash Point | 155.2°C |
| Solubility | Methanol (Slightly), Water (Slightly) |
| Vapor Presure | 1E-05mmHg at 25°C |
| Appearance | Waxy Solid or Coarse Crystals and Chunks |
| Color | White to Off-white |
| BRN | 81520 |
| pKa | 13.23±0.60(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | -19 ° (C=1, H2O) |
| MDL | MFCD00063295 |
| Physical and Chemical Properties | alpha:-19.2 o (c=1 in H2O) |
alpha-D-xylofuranose, 1,2-O-(1-methylethylidene)- - Risk and Safety
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10 |
| HS Code | 29321900 |
alpha-D-xylofuranose, 1,2-O-(1-methylethylidene)- - Reference Information
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| Use | 1, 2-O-isopropylidene-α-D-furan xylose can be used to prepare 3-deoxy-1, 2-O-isopropylidene-D-furan xylose. 3-Deoxy-1, 2-O-isopropylid-D-furanoxose is a chiral intermediate for the synthesis of atorvastatin to produce pharmacodynamic edge chains, and it is also the key to the synthesis of many other drug intermediates. Atorvastatin Calcium Tablets (Lipitor) is a lipid-lowering drug produced by Pfizer. As the world's most prescribed cholesterol-lowering drug and the number one prescription drug, it can significantly reduce low-density lipoprotein cholesterol and triglyceride levels. |
Last Update：2024-04-09 20:45:29
